From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
Renanolone |
|
| ATC code | |
|---|
|
3α-hydroxy-5β-pregnane-11,20-dione
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C21H32O3 |
|---|
| Molar mass | 332.484 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C
|
InChI=InChI=1S/C21H32O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h13-17,19,23H,4-11H2,1-3H3/t13-,14-,15+,16-,17+,19-,20+,21-/m1/s1 Key:DUHUCHOQIDJXAT-CSXWOMMHSA-N
|
Renanolone (INN; also known as 11-ketopregnanolone or 5β-pregnan-3α-ol-11,20-dione) is a synthetic[citation needed] neuroactive steroid which is described as a general anesthetic, but was never introduced for clinical use.[1] Its isomers, alfaxolone and alfadolone, are also general anesthetics, and are known to act as positive allosteric modulators of the GABAA receptor, a property which is likely the case for renanolone as well.
|
|---|
| Alcohols | |
|---|
| Barbiturates | |
|---|
| Benzodiazepines | |
|---|
| Carbamates | |
|---|
| Flavonoids | |
|---|
| Imidazoles | |
|---|
| Kava constituents | |
|---|
| Monoureides | |
|---|
| Neuroactive steroids | |
|---|
| Nonbenzodiazepines | |
|---|
| Phenols | |
|---|
| Piperidinediones | |
|---|
| Pyrazolopyridines | |
|---|
| Quinazolinones | |
|---|
| Volatiles/gases | |
|---|
| Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Alogabat
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Darigabat
- DEABL
- Deuterated etifoxine
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- KRM-II-81
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Nicotinic acid
- Nicotinamide
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
|---|
|